C20H26N4O2S — CID 147233188
amino 6-[cyclopropyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridine-3-carboxylate (PubChem CID 147233188) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is amino 6-[cyclopropyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridine-3-carboxylate.
| Compound Name | amino 6-[cyclopropyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 147233188 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | amino 6-[cyclopropyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridine-3-carboxylate |
| SMILES | CC1(C)CCC(C)(C)c2sc(N(c3ccc(C(=O)ON)cn3)C3CC3)nc21 |
| InChI | InChI=1S/C20H26N4O2S/c1-19(2)9-10-20(3,4)16-15(19)23-18(27-16)24(13-6-7-13)14-8-5-12(11-22-14)17(25)26-21/h5,8,11,13H,6-7,9-10,21H2,1-4H3 |
| InChIKey | CJHUSDIWWZMNDZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|