C22H28N3O3S+ — CID 144887607
6-[cyclobutanecarbonyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridin-1-ium-3-carboxylic acid (PubChem CID 144887607) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is 6-[cyclobutanecarbonyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridin-1-ium-3-carboxylic acid.
| Compound Name | 6-[cyclobutanecarbonyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 144887607 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 6-[cyclobutanecarbonyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]pyridin-1-ium-3-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2sc(N(C(=O)C3CCC3)c3ccc(C(=O)O)c[nH+]3)nc21 |
| InChI | InChI=1S/C22H27N3O3S/c1-21(2)10-11-22(3,4)17-16(21)24-20(29-17)25(18(26)13-6-5-7-13)15-9-8-14(12-23-15)19(27)28/h8-9,12-13H,5-7,10-11H2,1-4H3,(H,27,28)/p+1 |
| InChIKey | ZSIOGNWSEJDYIE-UHFFFAOYSA-O |
| XLogP | 4.47 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |