C20H21N3O2 — CID 178096883
4-[2-(5,5,8,8-tetramethyl-6,7-dihydro-1,2,4-benzotriazin-3-yl)ethynyl]benzoic acid (PubChem CID 178096883) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-[2-(5,5,8,8-tetramethyl-6,7-dihydro-1,2,4-benzotriazin-3-yl)ethynyl]benzoic acid.
| Compound Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydro-1,2,4-benzotriazin-3-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 178096883 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydro-1,2,4-benzotriazin-3-yl)ethynyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2nc(C#Cc3ccc(C(=O)O)cc3)nnc21 |
| InChI | InChI=1S/C20H21N3O2/c1-19(2)11-12-20(3,4)17-16(19)21-15(22-23-17)10-7-13-5-8-14(9-6-13)18(24)25/h5-6,8-9H,11-12H2,1-4H3,(H,24,25) |
| InChIKey | RGGKNIGJQLKRKX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|