C27H34N2S — CID 146385117
N-cyclohepta-1,6-dien-1-yl-4,4,7,7-tetramethyl-N-(4-prop-1-en-2-ylphenyl)-5,6-dihydro-1,3-benzothiazol-2-amine (PubChem CID 146385117) has the molecular formula C27H34N2S and a molecular weight of 418.65 g/mol. Its IUPAC name is N-cyclohepta-1,6-dien-1-yl-4,4,7,7-tetramethyl-N-(4-prop-1-en-2-ylphenyl)-5,6-dihydro-1,3-benzothiazol-2-amine.
| Compound Name | N-cyclohepta-1,6-dien-1-yl-4,4,7,7-tetramethyl-N-(4-prop-1-en-2-ylphenyl)-5,6-dihydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 146385117 |
| Molecular Formula | C27H34N2S |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-cyclohepta-1,6-dien-1-yl-4,4,7,7-tetramethyl-N-(4-prop-1-en-2-ylphenyl)-5,6-dihydro-1,3-benzothiazol-2-amine |
| SMILES | C=C(C)c1ccc(N(C2=CCCCC=C2)c2nc3c(s2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C27H34N2S/c1-19(2)20-13-15-22(16-14-20)29(21-11-9-7-8-10-12-21)25-28-23-24(30-25)27(5,6)18-17-26(23,3)4/h9,11-16H,1,7-8,10,17-18H2,2-6H3 |
| InChIKey | WYMSTLOYKKROCF-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |