C13H22N4 — CID 147245177
N-(4-ethylcyclohexyl)-4,6-dimethyl-1,3,5-triazin-2-amine (PubChem CID 147245177) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-4,6-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-ethylcyclohexyl)-4,6-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 147245177 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-(4-ethylcyclohexyl)-4,6-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CCC1CCC(Nc2nc(C)nc(C)n2)CC1 |
| InChI | InChI=1S/C13H22N4/c1-4-11-5-7-12(8-6-11)17-13-15-9(2)14-10(3)16-13/h11-12H,4-8H2,1-3H3,(H,14,15,16,17) |
| InChIKey | CLODHHWBNVGZEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |