C4H5F3O — CID 147250568
2,3-difluoro-3-(fluoromethoxy)prop-1-ene (PubChem CID 147250568) has the molecular formula C4H5F3O and a molecular weight of 126.08 g/mol. Its IUPAC name is 2,3-difluoro-3-(fluoromethoxy)prop-1-ene.
| Compound Name | 2,3-difluoro-3-(fluoromethoxy)prop-1-ene |
|---|---|
| PubChem CID | 147250568 |
| Molecular Formula | C4H5F3O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2,3-difluoro-3-(fluoromethoxy)prop-1-ene |
| SMILES | C=C(F)C(F)OCF |
| InChI | InChI=1S/C4H5F3O/c1-3(6)4(7)8-2-5/h4H,1-2H2 |
| InChIKey | CMPLKSHAOUXKPS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |