About N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine
N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine (PubChem CID 172957438) has the molecular formula C4H10F2N4O
and a molecular weight of 168.15 g/mol. Its IUPAC name is N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine.
Molecular Properties
| Compound Name | N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine |
| PubChem CID | 172957438 |
| Molecular Formula | C4H10F2N4O |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine |
| SMILES | C=C(N)CF.NO/N=C(\N)F |
| InChI | InChI=1S/C3H6FN.CH4FN3O/c1-3(5)2-4;2-1(3)5-6-4/h1-2,5H2;4H2,(H2,3,5) |
| InChIKey | CHGKGZDLMIQQEC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine?
The IUPAC name of N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine (CID 172957438) is N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine.
What is the SMILES notation for N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine?
The canonical SMILES for N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine is C=C(N)CF.NO/N=C(\N)F.
What is the InChIKey of N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine?
The InChIKey is CHGKGZDLMIQQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FN.CH4FN3O/c1-3(5)2-4;2-1(3)5-6-4/h1-2,5H2;4H2,(H2,3,5).
What are the key properties of N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine?
N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine has a molecular weight of 168.15 g/mol, XLogP of -0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminooxycarbamimidoyl fluoride;3-fluoroprop-1-en-2-amine is sourced from PubChem (CID 172957438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).