C33H35FN6O2 — CID 147261215
4-[(2S,5R)-4-[(4-fluorophenyl)-(4-morpholin-4-ylphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one (PubChem CID 147261215) has the molecular formula C33H35FN6O2 and a molecular weight of 566.68 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(4-fluorophenyl)-(4-morpholin-4-ylphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 4-[(2S,5R)-4-[(4-fluorophenyl)-(4-morpholin-4-ylphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 147261215 |
| Molecular Formula | C33H35FN6O2 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 4-[(2S,5R)-4-[(4-fluorophenyl)-(4-morpholin-4-ylphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@@H](C)N(C(c3ccc(F)cc3)c3ccc(N4CCOCC4)cc3)C[C@@H]1C)cc(=O)n2C |
| InChI | InChI=1S/C33H35FN6O2/c1-22-21-40(23(2)20-39(22)29-19-31(41)37(4)28-13-14-30(35-3)36-32(28)29)33(24-5-9-26(34)10-6-24)25-7-11-27(12-8-25)38-15-17-42-18-16-38/h5-14,19,22-23,33H,15-18,20-21H2,1-2,4H3/t22-,23+,33?/m0/s1 |
| InChIKey | COOZBBKFFKMTNT-JLNVSYFESA-N |
| XLogP | 5.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|