C28H24F3N5O — CID 153472716
4-[4-[bis(4-fluorophenyl)methyl]-2-(fluoromethyl)piperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one (PubChem CID 153472716) has the molecular formula C28H24F3N5O and a molecular weight of 503.53 g/mol. Its IUPAC name is 4-[4-[bis(4-fluorophenyl)methyl]-2-(fluoromethyl)piperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 4-[4-[bis(4-fluorophenyl)methyl]-2-(fluoromethyl)piperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 153472716 |
| Molecular Formula | C28H24F3N5O |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 4-[4-[bis(4-fluorophenyl)methyl]-2-(fluoromethyl)piperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1CF)cc(=O)n2C |
| InChI | InChI=1S/C28H24F3N5O/c1-32-25-12-11-23-27(33-25)24(15-26(37)34(23)2)36-14-13-35(17-22(36)16-29)28(18-3-7-20(30)8-4-18)19-5-9-21(31)10-6-19/h3-12,15,22,28H,13-14,16-17H2,2H3 |
| InChIKey | NAMJQUKJMQSXKW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|