C28H24F2N6O2 — CID 153472472
4-[bis(4-fluorophenyl)methyl]-1-(6-isocyano-1-methyl-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxamide (PubChem CID 153472472) has the molecular formula C28H24F2N6O2 and a molecular weight of 514.54 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-1-(6-isocyano-1-methyl-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxamide.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-1-(6-isocyano-1-methyl-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 153472472 |
| Molecular Formula | C28H24F2N6O2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-1-(6-isocyano-1-methyl-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1C(N)=O)cc(=O)n2C |
| InChI | InChI=1S/C28H24F2N6O2/c1-32-24-12-11-21-26(33-24)22(15-25(37)34(21)2)36-14-13-35(16-23(36)28(31)38)27(17-3-7-19(29)8-4-17)18-5-9-20(30)10-6-18/h3-12,15,23,27H,13-14,16H2,2H3,(H2,31,38) |
| InChIKey | BOUADMSUTNUBFA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|