C31H31Cl2N5O — CID 153472646
4-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-diethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one (PubChem CID 153472646) has the molecular formula C31H31Cl2N5O and a molecular weight of 560.53 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-diethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 4-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-diethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 153472646 |
| Molecular Formula | C31H31Cl2N5O |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 4-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-diethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@@H](CC)N(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C[C@@H]1CC)cc(=O)n2C |
| InChI | InChI=1S/C31H31Cl2N5O/c1-5-24-19-38(31(20-7-11-22(32)12-8-20)21-9-13-23(33)14-10-21)25(6-2)18-37(24)27-17-29(39)36(4)26-15-16-28(34-3)35-30(26)27/h7-17,24-25,31H,5-6,18-19H2,1-2,4H3/t24-,25+/m0/s1 |
| InChIKey | NANPUZFZXPAMJI-LOSJGSFVSA-N |
| XLogP | 7.26 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|