C28H26F2N6O — CID 153115363
4-[(2S,5R)-4-[(4-fluorophenyl)-(6-fluoro-2-pyridinyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one (PubChem CID 153115363) has the molecular formula C28H26F2N6O and a molecular weight of 500.55 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(4-fluorophenyl)-(6-fluoro-2-pyridinyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 4-[(2S,5R)-4-[(4-fluorophenyl)-(6-fluoro-2-pyridinyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 153115363 |
| Molecular Formula | C28H26F2N6O |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 4-[(2S,5R)-4-[(4-fluorophenyl)-(6-fluoro-2-pyridinyl)methyl]-2,5-dimethylpiperazin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@@H](C)N(C(c3ccc(F)cc3)c3cccc(F)n3)C[C@@H]1C)cc(=O)n2C |
| InChI | InChI=1S/C28H26F2N6O/c1-17-16-36(28(19-8-10-20(29)11-9-19)21-6-5-7-24(30)32-21)18(2)15-35(17)23-14-26(37)34(4)22-12-13-25(31-3)33-27(22)23/h5-14,17-18,28H,15-16H2,1-2,4H3/t17-,18+,28?/m0/s1 |
| InChIKey | VTTQXMNEAUJQJT-UWSFRVEYSA-N |
| XLogP | 4.85 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|