C11H26N+ — CID 147318009
2,3-dimethylbutan-2-yl-dimethyl-propan-2-ylazanium (PubChem CID 147318009) has the molecular formula C11H26N+ and a molecular weight of 172.34 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-dimethyl-propan-2-ylazanium.
| Compound Name | 2,3-dimethylbutan-2-yl-dimethyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 147318009 |
| Molecular Formula | C11H26N+ |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.21 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-dimethyl-propan-2-ylazanium |
| SMILES | CC(C)C(C)(C)[N+](C)(C)C(C)C |
| InChI | InChI=1S/C11H26N/c1-9(2)11(5,6)12(7,8)10(3)4/h9-10H,1-8H3/q+1 |
| InChIKey | TUXRKKYMZHOPDZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|