C31H32ClFN4O5 — CID 147319353
(E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-(3-oxabicyclo[3.1.0]hexan-6-ylmethoxy)quinazolin-6-yl]pent-3-en-2-one (PubChem CID 147319353) has the molecular formula C31H32ClFN4O5 and a molecular weight of 595.07 g/mol. Its IUPAC name is (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-(3-oxabicyclo[3.1.0]hexan-6-ylmethoxy)quinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-(3-oxabicyclo[3.1.0]hexan-6-ylmethoxy)quinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 147319353 |
| Molecular Formula | C31H32ClFN4O5 |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-(3-oxabicyclo[3.1.0]hexan-6-ylmethoxy)quinazolin-6-yl]pent-3-en-2-one |
| SMILES | O=C(/C=C/CN1C[C@@H]2OCCO[C@@H]2C1)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1C2COCC21 |
| InChI | InChI=1S/C31H32ClFN4O5/c32-25-10-19(3-4-26(25)33)36-31-21-9-18(8-20(38)2-1-5-37-12-29-30(13-37)41-7-6-40-29)28(11-27(21)34-17-35-31)42-16-24-22-14-39-15-23(22)24/h1-4,9-11,17,22-24,29-30H,5-8,12-16H2,(H,34,35,36)/b2-1+/t22?,23?,24?,29-,30+ |
| InChIKey | CZMMIXJNWLOZJV-ZNCCSSDLSA-N |
| XLogP | 4.20 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|