C11H18O3 — CID 14733185
1-(7-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)propan-2-ol (PubChem CID 14733185) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(7-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)propan-2-ol.
| Compound Name | 1-(7-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 14733185 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-(7-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)propan-2-ol |
| SMILES | CC(O)CC1=CC(C)CC12OCCO2 |
| InChI | InChI=1S/C11H18O3/c1-8-5-10(6-9(2)12)11(7-8)13-3-4-14-11/h5,8-9,12H,3-4,6-7H2,1-2H3 |
| InChIKey | VTMQYCJSIBIARA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|