C11H18O4 — CID 11806057
(1S,2R)-2-(2-hydroxyethyl)-4-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-ol (PubChem CID 11806057) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S,2R)-2-(2-hydroxyethyl)-4-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-ol.
| Compound Name | (1S,2R)-2-(2-hydroxyethyl)-4-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 11806057 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1S,2R)-2-(2-hydroxyethyl)-4-(2-methyl-1,3-dioxolan-2-yl)cyclopent-3-en-1-ol |
| SMILES | CC1(C2=C[C@@H](CCO)[C@@H](O)C2)OCCO1 |
| InChI | InChI=1S/C11H18O4/c1-11(14-4-5-15-11)9-6-8(2-3-12)10(13)7-9/h6,8,10,12-13H,2-5,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | JFFRJOAUHQOSBT-SCZZXKLOSA-N |
| XLogP | 0.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|