C22H20FN3O2 — CID 147353801
5-[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]-3H-1-benzofuran-2-one (PubChem CID 147353801) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 5-[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]-3H-1-benzofuran-2-one.
| Compound Name | 5-[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 147353801 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]-3H-1-benzofuran-2-one |
| SMILES | CC(C)(CNc1ccc(-c2ccc3c(c2)CC(=O)O3)nn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FN3O2/c1-22(2,16-4-6-17(23)7-5-16)13-24-20-10-8-18(25-26-20)14-3-9-19-15(11-14)12-21(27)28-19/h3-11H,12-13H2,1-2H3,(H,24,26) |
| InChIKey | DFXOKVSZWKGGCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|