C19H25FN6 — CID 142791172
6-(1-amino-3-ethyl-2H-imidazol-4-yl)-N-[2-(4-fluorophenyl)-2-methylpropyl]pyridazin-3-amine (PubChem CID 142791172) has the molecular formula C19H25FN6 and a molecular weight of 356.45 g/mol. Its IUPAC name is 6-(1-amino-3-ethyl-2H-imidazol-4-yl)-N-[2-(4-fluorophenyl)-2-methylpropyl]pyridazin-3-amine.
| Compound Name | 6-(1-amino-3-ethyl-2H-imidazol-4-yl)-N-[2-(4-fluorophenyl)-2-methylpropyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 142791172 |
| Molecular Formula | C19H25FN6 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 6-(1-amino-3-ethyl-2H-imidazol-4-yl)-N-[2-(4-fluorophenyl)-2-methylpropyl]pyridazin-3-amine |
| SMILES | CCN1CN(N)C=C1c1ccc(NCC(C)(C)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C19H25FN6/c1-4-25-13-26(21)11-17(25)16-9-10-18(24-23-16)22-12-19(2,3)14-5-7-15(20)8-6-14/h5-11H,4,12-13,21H2,1-3H3,(H,22,24) |
| InChIKey | CYHGTMBTJUAJMU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|