C21H25FN4O3 — CID 118498083
[[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazine-3-carbonyl]amino] 1-ethylcyclopropane-1-carboxylate (PubChem CID 118498083) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is [[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazine-3-carbonyl]amino] 1-ethylcyclopropane-1-carboxylate.
| Compound Name | [[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazine-3-carbonyl]amino] 1-ethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118498083 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]pyridazine-3-carbonyl]amino] 1-ethylcyclopropane-1-carboxylate |
| SMILES | CCC1(C(=O)ONC(=O)c2ccc(NCC(C)(C)c3ccc(F)cc3)nn2)CC1 |
| InChI | InChI=1S/C21H25FN4O3/c1-4-21(11-12-21)19(28)29-26-18(27)16-9-10-17(25-24-16)23-13-20(2,3)14-5-7-15(22)8-6-14/h5-10H,4,11-13H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | YBLIIJUJJWCFNZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|