C18H22FN3O2 — CID 54591946
methyl N-[[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-3-pyridinyl]methyl]carbamate (PubChem CID 54591946) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl N-[[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-3-pyridinyl]methyl]carbamate.
| Compound Name | methyl N-[[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 54591946 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | methyl N-[[6-[[2-(4-fluorophenyl)-2-methylpropyl]amino]-3-pyridinyl]methyl]carbamate |
| SMILES | COC(=O)NCc1ccc(NCC(C)(C)c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C18H22FN3O2/c1-18(2,14-5-7-15(19)8-6-14)12-22-16-9-4-13(10-20-16)11-21-17(23)24-3/h4-10H,11-12H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | NIZYECAEOBADEI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |