About 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane
5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane (PubChem CID 147357384) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane.
Molecular Properties
| Compound Name | 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane |
| PubChem CID | 147357384 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane |
| SMILES | CCOC1CC2CC3CC(C)CC1C32 |
| InChI | InChI=1S/C13H22O/c1-3-14-12-7-10-6-9-4-8(2)5-11(12)13(9)10/h8-13H,3-7H2,1-2H3 |
| InChIKey | DGOSBKURMQAOCO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane?
The IUPAC name of 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane (CID 147357384) is 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane.
What is the SMILES notation for 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane?
The canonical SMILES for 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane is CCOC1CC2CC3CC(C)CC1C32.
What is the InChIKey of 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane?
The InChIKey is DGOSBKURMQAOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-3-14-12-7-10-6-9-4-8(2)5-11(12)13(9)10/h8-13H,3-7H2,1-2H3.
What are the key properties of 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane?
5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane has a molecular weight of 194.32 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-8-methyltricyclo[4.3.1.03,10]decane is sourced from PubChem (CID 147357384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).