C16H13N3S — CID 14737702
2-(5-phenyl-3,4-dihydropyrazol-2-yl)-1,3-benzothiazole (PubChem CID 14737702) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-(5-phenyl-3,4-dihydropyrazol-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(5-phenyl-3,4-dihydropyrazol-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 14737702 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-(5-phenyl-3,4-dihydropyrazol-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc(C2=NN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C16H13N3S/c1-2-6-12(7-3-1)13-10-11-19(18-13)16-17-14-8-4-5-9-15(14)20-16/h1-9H,10-11H2 |
| InChIKey | PUURBTNDDFNNEI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |