C12H14N4S — CID 70422837
[1-(1,3-benzothiazol-2-yl)piperidin-4-ylidene]hydrazine (PubChem CID 70422837) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)piperidin-4-ylidene]hydrazine.
| Compound Name | [1-(1,3-benzothiazol-2-yl)piperidin-4-ylidene]hydrazine |
|---|---|
| PubChem CID | 70422837 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)piperidin-4-ylidene]hydrazine |
| SMILES | NN=C1CCN(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C12H14N4S/c13-15-9-5-7-16(8-6-9)12-14-10-3-1-2-4-11(10)17-12/h1-4H,5-8,13H2 |
| InChIKey | PULNKJBIVBVUJP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|