C16H25NOY-2 — CID 147378210
1-tert-butyl-4-phenylpiperidin-4-ol;carbanide;yttrium (PubChem CID 147378210) has the molecular formula C16H25NOY-2 and a molecular weight of 336.29 g/mol. Its IUPAC name is 1-tert-butyl-4-phenylpiperidin-4-ol;carbanide;yttrium.
| Compound Name | 1-tert-butyl-4-phenylpiperidin-4-ol;carbanide;yttrium |
|---|---|
| PubChem CID | 147378210 |
| Molecular Formula | C16H25NOY-2 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-tert-butyl-4-phenylpiperidin-4-ol;carbanide;yttrium |
| SMILES | CC(C)(C)N1CCC(O)(c2[c-]cccc2)CC1.[CH3-].[Y] |
| InChI | InChI=1S/C15H22NO.CH3.Y/c1-14(2,3)16-11-9-15(17,10-12-16)13-7-5-4-6-8-13;;/h4-7,17H,9-12H2,1-3H3;1H3;/q2*-1; |
| InChIKey | IMRSKLBPMRJAMW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|