C17H30N2O2Y-2 — CID 147380482
1-ethylazetidine;3-(2,2,3,3-tetramethylbutyl)pyrrolidin-1-ide-2,5-dione;yttrium (PubChem CID 147380482) has the molecular formula C17H30N2O2Y-2 and a molecular weight of 383.35 g/mol. Its IUPAC name is 1-ethylazetidine;3-(2,2,3,3-tetramethylbutyl)pyrrolidin-1-ide-2,5-dione;yttrium.
| Compound Name | 1-ethylazetidine;3-(2,2,3,3-tetramethylbutyl)pyrrolidin-1-ide-2,5-dione;yttrium |
|---|---|
| PubChem CID | 147380482 |
| Molecular Formula | C17H30N2O2Y-2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-ethylazetidine;3-(2,2,3,3-tetramethylbutyl)pyrrolidin-1-ide-2,5-dione;yttrium |
| SMILES | CC(C)(C)C(C)(C)CC1CC(=O)[N-]C1=O.[CH2-]CN1CCC1.[Y] |
| InChI | InChI=1S/C12H21NO2.C5H10N.Y/c1-11(2,3)12(4,5)7-8-6-9(14)13-10(8)15;1-2-6-4-3-5-6;/h8H,6-7H2,1-5H3,(H,13,14,15);1-5H2;/q;-1;/p-1 |
| InChIKey | RXLNFPYDZPMPKD-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|