C20H18N2O — CID 14738980
1-acetyl-2,4-diphenyl-3,4-dihydro-2H-pyridine-6-carbonitrile (PubChem CID 14738980) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-acetyl-2,4-diphenyl-3,4-dihydro-2H-pyridine-6-carbonitrile.
| Compound Name | 1-acetyl-2,4-diphenyl-3,4-dihydro-2H-pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 14738980 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-acetyl-2,4-diphenyl-3,4-dihydro-2H-pyridine-6-carbonitrile |
| SMILES | CC(=O)N1C(C#N)=CC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C20H18N2O/c1-15(23)22-19(14-21)12-18(16-8-4-2-5-9-16)13-20(22)17-10-6-3-7-11-17/h2-12,18,20H,13H2,1H3 |
| InChIKey | GQPGJRVGSRJPKI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |