C17H23N3O10P2 — CID 147393153
[hydroxy-[[(2R,5R)-3-hydroxy-5-[2-oxo-4-(phenylmethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid (PubChem CID 147393153) has the molecular formula C17H23N3O10P2 and a molecular weight of 491.33 g/mol. Its IUPAC name is [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-oxo-4-(phenylmethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid.
| Compound Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-oxo-4-(phenylmethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 147393153 |
| Molecular Formula | C17H23N3O10P2 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-[2-oxo-4-(phenylmethoxyamino)pyrimidin-1-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
| SMILES | O=c1nc(NOCc2ccccc2)ccn1[C@H]1CC(O)[C@@H](COP(=O)(O)CP(=O)(O)O)O1 |
| InChI | InChI=1S/C17H23N3O10P2/c21-13-8-16(30-14(13)10-29-32(26,27)11-31(23,24)25)20-7-6-15(18-17(20)22)19-28-9-12-4-2-1-3-5-12/h1-7,13-14,16,21H,8-11H2,(H,26,27)(H,18,19,22)(H2,23,24,25)/t13?,14-,16-/m1/s1 |
| InChIKey | DNGZCFZDXJGLBY-IGLHTZBQSA-N |
| XLogP | 0.77 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|