C29H52FN5O11P2 — CID 164616826
bis(N,N-diethylethanamine);[[(2R,3S,4R,5R)-5-[4-[(3-fluorophenyl)methoxyamino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 164616826) has the molecular formula C29H52FN5O11P2 and a molecular weight of 727.70 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);[[(2R,3S,4R,5R)-5-[4-[(3-fluorophenyl)methoxyamino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | bis(N,N-diethylethanamine);[[(2R,3S,4R,5R)-5-[4-[(3-fluorophenyl)methoxyamino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 164616826 |
| Molecular Formula | C29H52FN5O11P2 |
| Molecular Weight | 727.70 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | bis(N,N-diethylethanamine);[[(2R,3S,4R,5R)-5-[4-[(3-fluorophenyl)methoxyamino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CCN(CC)CC.CCN(CC)CC.O=c1nc(NOCc2cccc(F)c2)ccn1[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H22FN3O11P2.2C6H15N/c18-11-3-1-2-10(6-11)7-30-20-13-4-5-21(17(24)19-13)16-15(23)14(22)12(32-16)8-31-34(28,29)9-33(25,26)27;2*1-4-7(5-2)6-3/h1-6,12,14-16,22-23H,7-9H2,(H,28,29)(H,19,20,24)(H2,25,26,27);2*4-6H2,1-3H3/t12-,14-,15-,16-;;/m1../s1 |
| InChIKey | XGJLMWLTGNYFPU-BWBFMJMBSA-N |
| XLogP | 2.58 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|