C18H22F3N3O11P2 — CID 147136815
[[(2R,5R)-3,4-dihydroxy-5-[2-oxo-4-[[4-(trifluoromethyl)phenyl]methoxyamino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 147136815) has the molecular formula C18H22F3N3O11P2 and a molecular weight of 575.33 g/mol. Its IUPAC name is [[(2R,5R)-3,4-dihydroxy-5-[2-oxo-4-[[4-(trifluoromethyl)phenyl]methoxyamino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,5R)-3,4-dihydroxy-5-[2-oxo-4-[[4-(trifluoromethyl)phenyl]methoxyamino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 147136815 |
| Molecular Formula | C18H22F3N3O11P2 |
| Molecular Weight | 575.33 g/mol |
| Exact Mass | 575.07 |
| IUPAC Name | [[(2R,5R)-3,4-dihydroxy-5-[2-oxo-4-[[4-(trifluoromethyl)phenyl]methoxyamino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=c1nc(NOCc2ccc(C(F)(F)F)cc2)ccn1[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C18H22F3N3O11P2/c19-18(20,21)11-3-1-10(2-4-11)7-33-23-13-5-6-24(17(27)22-13)16-15(26)14(25)12(35-16)8-34-37(31,32)9-36(28,29)30/h1-6,12,14-16,25-26H,7-9H2,(H,31,32)(H,22,23,27)(H2,28,29,30)/t12-,14?,15?,16-/m1/s1 |
| InChIKey | BRIARVXOCSKYNP-TWRYWWQQSA-N |
| XLogP | 0.76 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|