C20H29N3O11P2 — CID 176732500
[[(2R,3S,4R,5R)-5-[4-[(4-ethylphenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 176732500) has the molecular formula C20H29N3O11P2 and a molecular weight of 549.41 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[4-[(4-ethylphenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[4-[(4-ethylphenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 176732500 |
| Molecular Formula | C20H29N3O11P2 |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[4-[(4-ethylphenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CCc1ccc(CON=c2ccn([C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]3O)c(=O)n2C)cc1 |
| InChI | InChI=1S/C20H29N3O11P2/c1-3-13-4-6-14(7-5-13)10-32-21-16-8-9-23(20(26)22(16)2)19-18(25)17(24)15(34-19)11-33-36(30,31)12-35(27,28)29/h4-9,15,17-19,24-25H,3,10-12H2,1-2H3,(H,30,31)(H2,27,28,29)/t15-,17-,18-,19-/m1/s1 |
| InChIKey | WIHJLFCLYKBASW-NXWXRZEISA-N |
| XLogP | -0.26 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|