C19H27N3O11P2 — CID 166625499
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-4-[(4-methylphenyl)methoxyimino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 166625499) has the molecular formula C19H27N3O11P2 and a molecular weight of 535.38 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-4-[(4-methylphenyl)methoxyimino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-4-[(4-methylphenyl)methoxyimino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 166625499 |
| Molecular Formula | C19H27N3O11P2 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-4-[(4-methylphenyl)methoxyimino]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cc1ccc(CO/N=c2/ccn([C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]3O)c(=O)n2C)cc1 |
| InChI | InChI=1S/C19H27N3O11P2/c1-12-3-5-13(6-4-12)9-31-20-15-7-8-22(19(25)21(15)2)18-17(24)16(23)14(33-18)10-32-35(29,30)11-34(26,27)28/h3-8,14,16-18,23-24H,9-11H2,1-2H3,(H,29,30)(H2,26,27,28)/b20-15-/t14-,16-,17-,18-/m1/s1 |
| InChIKey | JLSDMZVIDLJQIW-LUEWZKGUSA-N |
| XLogP | -0.52 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|