C18H24F5N3O11P2S — CID 166625443
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-2-oxo-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methoxyimino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 166625443) has the molecular formula C18H24F5N3O11P2S and a molecular weight of 647.40 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-2-oxo-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methoxyimino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-2-oxo-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methoxyimino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 166625443 |
| Molecular Formula | C18H24F5N3O11P2S |
| Molecular Weight | 647.40 g/mol |
| Exact Mass | 647.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(4Z)-3-methyl-2-oxo-4-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methoxyimino]pyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cn1c(=O)n([C@@H]2O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]2O)cc/c1=N/OCc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F5N3O11P2S/c1-25-14(24-35-8-11-2-4-12(5-3-11)40(19,20,21,22)23)6-7-26(18(25)29)17-16(28)15(27)13(37-17)9-36-39(33,34)10-38(30,31)32/h2-7,13,15-17,27-28H,8-10H2,1H3,(H,33,34)(H2,30,31,32)/b24-14-/t13-,15-,16-,17-/m1/s1 |
| InChIKey | UQDLNAFZEUBNQV-BEZWNFSFSA-N |
| XLogP | 1.83 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|