C9H8IN2O- — CID 147393466
3-methyliodanuidyl-4-phenyl-1,2,5-oxadiazole (PubChem CID 147393466) has the molecular formula C9H8IN2O- and a molecular weight of 287.08 g/mol. Its IUPAC name is 3-methyliodanuidyl-4-phenyl-1,2,5-oxadiazole.
| Compound Name | 3-methyliodanuidyl-4-phenyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 147393466 |
| Molecular Formula | C9H8IN2O- |
| Molecular Weight | 287.08 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 3-methyliodanuidyl-4-phenyl-1,2,5-oxadiazole |
| SMILES | C[I-]c1nonc1-c1ccccc1 |
| InChI | InChI=1S/C9H8IN2O/c1-10-9-8(11-13-12-9)7-5-3-2-4-6-7/h2-6H,1H3/q-1 |
| InChIKey | ZRWCDJAHGPPVOO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.08 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|