C6H11N3 — CID 147395355
6-methanimidoyl-1,2,3,4-tetrahydropyridin-5-amine (PubChem CID 147395355) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 6-methanimidoyl-1,2,3,4-tetrahydropyridin-5-amine.
| Compound Name | 6-methanimidoyl-1,2,3,4-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 147395355 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 6-methanimidoyl-1,2,3,4-tetrahydropyridin-5-amine |
| SMILES | [H]/N=C/C1=C(N)CCCN1 |
| InChI | InChI=1S/C6H11N3/c7-4-6-5(8)2-1-3-9-6/h4,7,9H,1-3,8H2/b7-4+ |
| InChIKey | DNRODICAIGRDOO-QPJJXVBHSA-N |
| XLogP | 0.19 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|