C24H32BN2O6 — CID 147424717
CID 147424717 (PubChem CID 147424717) has the molecular formula C24H32BN2O6 and a molecular weight of 455.34 g/mol.
| Compound Name | CID 147424717 |
|---|---|
| PubChem CID | 147424717 |
| Molecular Formula | C24H32BN2O6 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(Cc1cc(-c2cncnc2)ccc1[B]OC(C)(C)C(C)(C)O)C(=O)OCC |
| InChI | InChI=1S/C24H32BN2O6/c1-7-31-21(28)19(22(29)32-8-2)12-17-11-16(18-13-26-15-27-14-18)9-10-20(17)25-33-24(5,6)23(3,4)30/h9-11,13-15,19,30H,7-8,12H2,1-6H3 |
| InChIKey | FVOAANFLEZEOOO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|