C23H31BN2O4 — CID 153427724
ethyl 2-[[5-pyrimidin-5-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butanoate (PubChem CID 153427724) has the molecular formula C23H31BN2O4 and a molecular weight of 410.32 g/mol. Its IUPAC name is ethyl 2-[[5-pyrimidin-5-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[[5-pyrimidin-5-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 153427724 |
| Molecular Formula | C23H31BN2O4 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | ethyl 2-[[5-pyrimidin-5-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1cc(-c2cncnc2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H31BN2O4/c1-7-16(21(27)28-8-2)11-18-12-17(19-13-25-15-26-14-19)9-10-20(18)24-29-22(3,4)23(5,6)30-24/h9-10,12-16H,7-8,11H2,1-6H3 |
| InChIKey | XPJHVFUUMGKKNC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|