C17H23BN2O4 — CID 71071755
2-[[6-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]butanoic acid (PubChem CID 71071755) has the molecular formula C17H23BN2O4 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-[[6-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]butanoic acid.
| Compound Name | 2-[[6-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 71071755 |
| Molecular Formula | C17H23BN2O4 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[[6-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]butanoic acid |
| SMILES | CCC(Cc1cnc(C#N)c(B2OC(C)(C)C(C)(C)O2)c1)C(=O)O |
| InChI | InChI=1S/C17H23BN2O4/c1-6-12(15(21)22)7-11-8-13(14(9-19)20-10-11)18-23-16(2,3)17(4,5)24-18/h8,10,12H,6-7H2,1-5H3,(H,21,22) |
| InChIKey | SPQXZIIVLHPBLH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|