C16H24BNO5 — CID 175221640
2-amino-3-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid (PubChem CID 175221640) has the molecular formula C16H24BNO5 and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-amino-3-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 175221640 |
| Molecular Formula | C16H24BNO5 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-amino-3-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid |
| SMILES | COc1ccc(CC(N)C(=O)O)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H24BNO5/c1-15(2)16(3,4)23-17(22-15)11-8-10(6-7-13(11)21-5)9-12(18)14(19)20/h6-8,12H,9,18H2,1-5H3,(H,19,20) |
| InChIKey | JXCQWBMWODQQNN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|