C25H24ClFN4O3 — CID 147432116
N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxy-5-methylbenzamide (PubChem CID 147432116) has the molecular formula C25H24ClFN4O3 and a molecular weight of 482.94 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxy-5-methylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 147432116 |
| Molecular Formula | C25H24ClFN4O3 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxy-5-methylbenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2c(OC)cc(C)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C25H24ClFN4O3/c1-14-9-19(25(33)30-23-8-6-16(26)13-29-23)18(22(10-14)34-4)12-21(32)17-7-5-15(11-20(17)27)24(28)31(2)3/h5-11,13,28H,12H2,1-4H3,(H,29,30,33)/b28-24- |
| InChIKey | DUNWQQPIBVVBFT-COOPMVRXSA-N |
| XLogP | 4.76 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|