C23H32N2O3S — CID 14747781
N-(cyclohexylmethyl)-5-[(2-oxo-1H-quinolin-6-yl)oxy]-N-(2-sulfanylethyl)pentanamide (PubChem CID 14747781) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5-[(2-oxo-1H-quinolin-6-yl)oxy]-N-(2-sulfanylethyl)pentanamide.
| Compound Name | N-(cyclohexylmethyl)-5-[(2-oxo-1H-quinolin-6-yl)oxy]-N-(2-sulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 14747781 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(cyclohexylmethyl)-5-[(2-oxo-1H-quinolin-6-yl)oxy]-N-(2-sulfanylethyl)pentanamide |
| SMILES | O=C(CCCCOc1ccc2[nH]c(=O)ccc2c1)N(CCS)CC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O3S/c26-22-12-9-19-16-20(10-11-21(19)24-22)28-14-5-4-8-23(27)25(13-15-29)17-18-6-2-1-3-7-18/h9-12,16,18,29H,1-8,13-15,17H2,(H,24,26) |
| InChIKey | PGNRUQXGXKJMKY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|