C21H28N2O5 — CID 13288178
N-(3-hydroxycyclohexyl)-N-(2-hydroxyethyl)-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 13288178) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-(3-hydroxycyclohexyl)-N-(2-hydroxyethyl)-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-(3-hydroxycyclohexyl)-N-(2-hydroxyethyl)-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 13288178 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-(3-hydroxycyclohexyl)-N-(2-hydroxyethyl)-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | O=C(CCCOc1ccc2[nH]c(=O)ccc2c1)N(CCO)C1CCCC(O)C1 |
| InChI | InChI=1S/C21H28N2O5/c24-11-10-23(16-3-1-4-17(25)14-16)21(27)5-2-12-28-18-7-8-19-15(13-18)6-9-20(26)22-19/h6-9,13,16-17,24-25H,1-5,10-12,14H2,(H,22,26) |
| InChIKey | VRBDJIXPYHZXOX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|