C32H49N3O7 — CID 14747792
N-(cyclooctylmethyl)-N-[3-(diethylamino)propyl]-5-[(2-oxo-1H-quinolin-6-yl)oxy]pentanamide;oxalic acid (PubChem CID 14747792) has the molecular formula C32H49N3O7 and a molecular weight of 587.76 g/mol. Its IUPAC name is N-(cyclooctylmethyl)-N-[3-(diethylamino)propyl]-5-[(2-oxo-1H-quinolin-6-yl)oxy]pentanamide;oxalic acid.
| Compound Name | N-(cyclooctylmethyl)-N-[3-(diethylamino)propyl]-5-[(2-oxo-1H-quinolin-6-yl)oxy]pentanamide;oxalic acid |
|---|---|
| PubChem CID | 14747792 |
| Molecular Formula | C32H49N3O7 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | N-(cyclooctylmethyl)-N-[3-(diethylamino)propyl]-5-[(2-oxo-1H-quinolin-6-yl)oxy]pentanamide;oxalic acid |
| SMILES | CCN(CC)CCCN(CC1CCCCCCC1)C(=O)CCCCOc1ccc2[nH]c(=O)ccc2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C30H47N3O3.C2H2O4/c1-3-32(4-2)20-12-21-33(24-25-13-8-6-5-7-9-14-25)30(35)15-10-11-22-36-27-17-18-28-26(23-27)16-19-29(34)31-28;3-1(4)2(5)6/h16-19,23,25H,3-15,20-22,24H2,1-2H3,(H,31,34);(H,3,4)(H,5,6) |
| InChIKey | WGDBQRALYJKKFW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|