C25H35N3O5 — CID 70191424
1-cyclopropyl-1-[(1S,2S)-2-(3-hydroxypropoxy)cyclohexyl]-3-[3-[(2-oxo-1H-quinolin-6-yl)oxy]propyl]urea (PubChem CID 70191424) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(1S,2S)-2-(3-hydroxypropoxy)cyclohexyl]-3-[3-[(2-oxo-1H-quinolin-6-yl)oxy]propyl]urea.
| Compound Name | 1-cyclopropyl-1-[(1S,2S)-2-(3-hydroxypropoxy)cyclohexyl]-3-[3-[(2-oxo-1H-quinolin-6-yl)oxy]propyl]urea |
|---|---|
| PubChem CID | 70191424 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 1-cyclopropyl-1-[(1S,2S)-2-(3-hydroxypropoxy)cyclohexyl]-3-[3-[(2-oxo-1H-quinolin-6-yl)oxy]propyl]urea |
| SMILES | O=C(NCCCOc1ccc2[nH]c(=O)ccc2c1)N(C1CC1)[C@H]1CCCC[C@@H]1OCCCO |
| InChI | InChI=1S/C25H35N3O5/c29-14-4-16-33-23-6-2-1-5-22(23)28(19-8-9-19)25(31)26-13-3-15-32-20-10-11-21-18(17-20)7-12-24(30)27-21/h7,10-12,17,19,22-23,29H,1-6,8-9,13-16H2,(H,26,31)(H,27,30)/t22-,23-/m0/s1 |
| InChIKey | AKUDAXPMTNSLPH-GOTSBHOMSA-N |
| XLogP | 3.18 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|