C23H30N2O4 — CID 158167130
1-cyclopropyl-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[3-[(6-oxo-5H-naphthalen-2-yl)oxy]propyl]urea (PubChem CID 158167130) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[3-[(6-oxo-5H-naphthalen-2-yl)oxy]propyl]urea.
| Compound Name | 1-cyclopropyl-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[3-[(6-oxo-5H-naphthalen-2-yl)oxy]propyl]urea |
|---|---|
| PubChem CID | 158167130 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-cyclopropyl-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[3-[(6-oxo-5H-naphthalen-2-yl)oxy]propyl]urea |
| SMILES | O=C1C=Cc2cc(OCCCNC(=O)N(C3CC3)[C@@H]3CCCC[C@H]3O)ccc2C1 |
| InChI | InChI=1S/C23H30N2O4/c26-19-10-6-17-15-20(11-7-16(17)14-19)29-13-3-12-24-23(28)25(18-8-9-18)21-4-1-2-5-22(21)27/h6-7,10-11,15,18,21-22,27H,1-5,8-9,12-14H2,(H,24,28)/t21-,22-/m1/s1 |
| InChIKey | FWZDXRFCSFLKNZ-FGZHOGPDSA-N |
| XLogP | 3.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|