C10H15NO3S — CID 147489916
5-ethyl-3-methyl-1,1-dioxo-3,3a,4,5,6,6a-hexahydrocyclopenta[c]oxathiole-6-carbonitrile (PubChem CID 147489916) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 5-ethyl-3-methyl-1,1-dioxo-3,3a,4,5,6,6a-hexahydrocyclopenta[c]oxathiole-6-carbonitrile.
| Compound Name | 5-ethyl-3-methyl-1,1-dioxo-3,3a,4,5,6,6a-hexahydrocyclopenta[c]oxathiole-6-carbonitrile |
|---|---|
| PubChem CID | 147489916 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 5-ethyl-3-methyl-1,1-dioxo-3,3a,4,5,6,6a-hexahydrocyclopenta[c]oxathiole-6-carbonitrile |
| SMILES | CCC1CC2C(C)OS(=O)(=O)C2C1C#N |
| InChI | InChI=1S/C10H15NO3S/c1-3-7-4-8-6(2)14-15(12,13)10(8)9(7)5-11/h6-10H,3-4H2,1-2H3 |
| InChIKey | FFHSIPBIPPTTBG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|