About 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile
9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile (PubChem CID 131965997) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile.
Molecular Properties
| Compound Name | 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile |
| PubChem CID | 131965997 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile |
| SMILES | CC1C2CC3C1NS(=O)(=O)C3C2C#N |
| InChI | InChI=1S/C9H12N2O2S/c1-4-5-2-6-8(4)11-14(12,13)9(6)7(5)3-10/h4-9,11H,2H2,1H3 |
| InChIKey | YBDHDGWKWCNVBQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile?
The IUPAC name of 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile (CID 131965997) is 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile.
What is the SMILES notation for 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile?
The canonical SMILES for 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile is CC1C2CC3C1NS(=O)(=O)C3C2C#N.
What is the InChIKey of 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile?
The InChIKey is YBDHDGWKWCNVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-4-5-2-6-8(4)11-14(12,13)9(6)7(5)3-10/h4-9,11H,2H2,1H3.
What are the key properties of 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile?
9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile has a molecular weight of 212.27 g/mol, XLogP of 0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-4,4-dioxo-4λ6-thia-5-azatricyclo[4.2.1.03,7]nonane-2-carbonitrile is sourced from PubChem (CID 131965997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).