C10H18N2 — CID 137427555
(5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile (PubChem CID 137427555) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile.
| Compound Name | (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 137427555 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile |
| SMILES | CC1C(N)C(C#N)C[C@@H](C)C1C |
| InChI | InChI=1S/C10H18N2/c1-6-4-9(5-11)10(12)8(3)7(6)2/h6-10H,4,12H2,1-3H3/t6-,7?,8?,9?,10?/m1/s1 |
| InChIKey | OGKZKODPCKAXSC-VUTZLFHMSA-N |
| XLogP | 1.77 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |