About (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile
(5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile (PubChem CID 137427555) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile |
| PubChem CID | 137427555 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile |
| SMILES | CC1C(N)C(C#N)C[C@@H](C)C1C |
| InChI | InChI=1S/C10H18N2/c1-6-4-9(5-11)10(12)8(3)7(6)2/h6-10H,4,12H2,1-3H3/t6-,7?,8?,9?,10?/m1/s1 |
| InChIKey | OGKZKODPCKAXSC-VUTZLFHMSA-N |
| XLogP | 1.77 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile?
The IUPAC name of (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile (CID 137427555) is (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile.
What is the SMILES notation for (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile?
The canonical SMILES for (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile is CC1C(N)C(C#N)C[C@@H](C)C1C.
What is the InChIKey of (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile?
The InChIKey is OGKZKODPCKAXSC-VUTZLFHMSA-N. The full InChI is InChI=1S/C10H18N2/c1-6-4-9(5-11)10(12)8(3)7(6)2/h6-10H,4,12H2,1-3H3/t6-,7?,8?,9?,10?/m1/s1.
What are the key properties of (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile?
(5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile has a molecular weight of 166.27 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-amino-3,4,5-trimethylcyclohexane-1-carbonitrile is sourced from PubChem (CID 137427555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).