About (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile
(1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile (PubChem CID 167531480) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile.
Analyze (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile?
The IUPAC name of (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile (CID 167531480) is (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile.
What is the SMILES notation for (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile?
The canonical SMILES for (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile is CC1CC2C[C@H]2[C@@H](C#N)C1.
What is the InChIKey of (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile?
The InChIKey is AAIDSJSGOSNOQH-GEPGNKONSA-N. The full InChI is InChI=1S/C9H13N/c1-6-2-7-4-9(7)8(3-6)5-10/h6-9H,2-4H2,1H3/t6?,7?,8-,9-/m1/s1.
What are the key properties of (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile?
(1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile has a molecular weight of 135.21 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-4-methylbicyclo[4.1.0]heptane-2-carbonitrile is sourced from PubChem (CID 167531480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).