C35H38N4O7 — CID 147498457
1-(2-methylpropanoyloxy)ethyl 3-[2-[2-(4-carbamimidoylphenyl)acetyl]-4-ethenyl-5-(hydroxymethyl)phenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 147498457) has the molecular formula C35H38N4O7 and a molecular weight of 626.71 g/mol. Its IUPAC name is 1-(2-methylpropanoyloxy)ethyl 3-[2-[2-(4-carbamimidoylphenyl)acetyl]-4-ethenyl-5-(hydroxymethyl)phenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 1-(2-methylpropanoyloxy)ethyl 3-[2-[2-(4-carbamimidoylphenyl)acetyl]-4-ethenyl-5-(hydroxymethyl)phenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 147498457 |
| Molecular Formula | C35H38N4O7 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 1-(2-methylpropanoyloxy)ethyl 3-[2-[2-(4-carbamimidoylphenyl)acetyl]-4-ethenyl-5-(hydroxymethyl)phenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(CC(=O)c2cc(C=C)c(CO)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OC(C)OC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C35H38N4O7/c1-5-23-15-28(30(41)14-21-8-10-24(11-9-21)32(36)37)27(16-25(23)18-40)26-12-13-29(33(42)38-17-22-6-7-22)39-31(26)35(44)46-20(4)45-34(43)19(2)3/h5,8-13,15-16,19-20,22,40H,1,6-7,14,17-18H2,2-4H3,(H3,36,37)(H,38,42) |
| InChIKey | FGYGZZCZNNIIJM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|