C26H20N2O3 — CID 147501226
(2R)-2-(carbazole-9-carbonylamino)-3-naphthalen-2-ylpropanoic acid (PubChem CID 147501226) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2R)-2-(carbazole-9-carbonylamino)-3-naphthalen-2-ylpropanoic acid.
| Compound Name | (2R)-2-(carbazole-9-carbonylamino)-3-naphthalen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 147501226 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (2R)-2-(carbazole-9-carbonylamino)-3-naphthalen-2-ylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C26H20N2O3/c29-25(30)22(16-17-13-14-18-7-1-2-8-19(18)15-17)27-26(31)28-23-11-5-3-9-20(23)21-10-4-6-12-24(21)28/h1-15,22H,16H2,(H,27,31)(H,29,30)/t22-/m1/s1 |
| InChIKey | FHLMLUGPILBINM-JOCHJYFZSA-N |
| XLogP | 5.20 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |